About [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate
[4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate (PubChem CID 101052638) has the molecular formula C36H34O11
and a molecular weight of 642.66 g/mol. Its IUPAC name is [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate.
Molecular Properties
| Compound Name | [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate |
| PubChem CID | 101052638 |
| Molecular Formula | C36H34O11 |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C(=O)OCCOCCOC(=O)c3ccc(OC(=O)c4ccc(OCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H34O11/c1-3-42-29-13-5-27(6-14-29)35(39)46-31-17-9-25(10-18-31)33(37)44-23-21-41-22-24-45-34(38)26-11-19-32(20-12-26)47-36(40)28-7-15-30(16-8-28)43-4-2/h5-20H,3-4,21-24H2,1-2H3 |
| InChIKey | HFUNTNWITACYTJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate?
The IUPAC name of [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate (CID 101052638) is [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate.
What is the SMILES notation for [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate?
The canonical SMILES for [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate is CCOc1ccc(C(=O)Oc2ccc(C(=O)OCCOCCOC(=O)c3ccc(OC(=O)c4ccc(OCC)cc4)cc3)cc2)cc1.
What is the InChIKey of [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate?
The InChIKey is HFUNTNWITACYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H34O11/c1-3-42-29-13-5-27(6-14-29)35(39)46-31-17-9-25(10-18-31)33(37)44-23-21-41-22-24-45-34(38)26-11-19-32(20-12-26)47-36(40)28-7-15-30(16-8-28)43-4-2/h5-20H,3-4,21-24H2,1-2H3.
What are the key properties of [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate?
[4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate has a molecular weight of 642.66 g/mol, XLogP of 5.95, 16 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[2-[4-(4-ethoxybenzoyl)oxybenzoyl]oxyethoxy]ethoxycarbonyl]phenyl] 4-ethoxybenzoate is sourced from PubChem (CID 101052638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).