About [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate
[4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate (PubChem CID 3529372) has the molecular formula C25H22O5
and a molecular weight of 402.45 g/mol. Its IUPAC name is [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate |
| PubChem CID | 3529372 |
| Molecular Formula | C25H22O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate |
| SMILES | CCOc1ccc(C=CC(=O)c2ccc(OC(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H22O5/c1-3-29-22-11-4-18(5-12-22)6-17-24(26)19-7-15-23(16-8-19)30-25(27)20-9-13-21(28-2)14-10-20/h4-17H,3H2,1-2H3 |
| InChIKey | YZTFPPMOQMKXQA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate?
The IUPAC name of [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate (CID 3529372) is [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate.
What is the SMILES notation for [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate?
The canonical SMILES for [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate is CCOc1ccc(C=CC(=O)c2ccc(OC(=O)c3ccc(OC)cc3)cc2)cc1.
What is the InChIKey of [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate?
The InChIKey is YZTFPPMOQMKXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O5/c1-3-29-22-11-4-18(5-12-22)6-17-24(26)19-7-15-23(16-8-19)30-25(27)20-9-13-21(28-2)14-10-20/h4-17H,3H2,1-2H3.
What are the key properties of [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate?
[4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate has a molecular weight of 402.45 g/mol, XLogP of 5.21, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 4-methoxybenzoate is sourced from PubChem (CID 3529372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).