C25H20O6 — CID 3552589
[4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 3552589) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 3552589 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [4-[3-(4-ethoxyphenyl)prop-2-enoyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOc1ccc(C=CC(=O)c2ccc(OC(=O)c3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C25H20O6/c1-2-28-20-9-3-17(4-10-20)5-13-22(26)18-6-11-21(12-7-18)31-25(27)19-8-14-23-24(15-19)30-16-29-23/h3-15H,2,16H2,1H3 |
| InChIKey | WGTGRDVZABODMW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|