C20H20O3 — CID 5345192
(Z)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)prop-2-en-1-one (PubChem CID 5345192) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (Z)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)prop-2-en-1-one.
| Compound Name | (Z)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5345192 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (Z)-1-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(/C=C\C(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H20O3/c1-20(2,3)16-8-4-14(5-9-16)6-10-17(21)15-7-11-18-19(12-15)23-13-22-18/h4-12H,13H2,1-3H3/b10-6- |
| InChIKey | DKCRWBSSRZAIIY-POHAHGRESA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|