C22H22O6 — CID 137470407
2-[4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid (PubChem CID 137470407) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-[4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 137470407 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
| SMILES | Cc1cc(/C=C/C(=O)c2ccc3c(c2)OCO3)cc(C)c1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H22O6/c1-13-9-15(10-14(2)20(13)28-22(3,4)21(24)25)5-7-17(23)16-6-8-18-19(11-16)27-12-26-18/h5-11H,12H2,1-4H3,(H,24,25)/b7-5+ |
| InChIKey | WAADKWDFBYPRRF-FNORWQNLSA-N |
| XLogP | 4.17 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|