C17H13FO3 — CID 39384253
(E)-3-(1,3-benzodioxol-5-yl)-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one (PubChem CID 39384253) has the molecular formula C17H13FO3 and a molecular weight of 284.29 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 39384253 |
| Molecular Formula | C17H13FO3 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc3c(c2)OCO3)ccc1F |
| InChI | InChI=1S/C17H13FO3/c1-11-8-13(4-5-14(11)18)15(19)6-2-12-3-7-16-17(9-12)21-10-20-16/h2-9H,10H2,1H3/b6-2+ |
| InChIKey | YPUOFESLJZOQEO-QHHAFSJGSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|