C17H11NO3 — CID 10850129
4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile (PubChem CID 10850129) has the molecular formula C17H11NO3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile.
| Compound Name | 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile |
|---|---|
| PubChem CID | 10850129 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H11NO3/c18-10-13-1-5-14(6-2-13)15(19)7-3-12-4-8-16-17(9-12)21-11-20-16/h1-9H,11H2/b7-3+ |
| InChIKey | WGNRJVQUFKICMC-XVNBXDOJSA-N |
| XLogP | 3.18 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|