C17H10BrNO3 — CID 18076906
4-[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile (PubChem CID 18076906) has the molecular formula C17H10BrNO3 and a molecular weight of 356.18 g/mol. Its IUPAC name is 4-[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile.
| Compound Name | 4-[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile |
|---|---|
| PubChem CID | 18076906 |
| Molecular Formula | C17H10BrNO3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 4-[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)/C=C/c2cc3c(cc2Br)OCO3)cc1 |
| InChI | InChI=1S/C17H10BrNO3/c18-14-8-17-16(21-10-22-17)7-13(14)5-6-15(20)12-3-1-11(9-19)2-4-12/h1-8H,10H2/b6-5+ |
| InChIKey | JQBXUJLYFNGUTG-AATRIKPKSA-N |
| XLogP | 3.95 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|