C16H10BrNO2 — CID 126371449
(Z)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-phenylprop-2-enenitrile (PubChem CID 126371449) has the molecular formula C16H10BrNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is (Z)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126371449 |
| Molecular Formula | C16H10BrNO2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | (Z)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc2c(cc1Br)OCO2)c1ccccc1 |
| InChI | InChI=1S/C16H10BrNO2/c17-14-8-16-15(19-10-20-16)7-12(14)6-13(9-18)11-4-2-1-3-5-11/h1-8H,10H2/b13-6+ |
| InChIKey | YCVBRYDJOUSUMY-AWNIVKPZSA-N |
| XLogP | 4.24 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|