C15H13BrN6O2 — CID 17479840
(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile (PubChem CID 17479840) has the molecular formula C15H13BrN6O2 and a molecular weight of 389.21 g/mol. Its IUPAC name is (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17479840 |
| Molecular Formula | C15H13BrN6O2 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile |
| SMILES | CN(C)c1nc(N)nc(/C(C#N)=C/c2cc3c(cc2Br)OCO3)n1 |
| InChI | InChI=1S/C15H13BrN6O2/c1-22(2)15-20-13(19-14(18)21-15)9(6-17)3-8-4-11-12(5-10(8)16)24-7-23-11/h3-5H,7H2,1-2H3,(H2,18,19,20,21)/b9-3+ |
| InChIKey | IZXKIGAHLPOMMU-YCRREMRBSA-N |
| XLogP | 2.08 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|