C14H12Cl2N6 — CID 17393042
(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 17393042) has the molecular formula C14H12Cl2N6 and a molecular weight of 335.20 g/mol. Its IUPAC name is (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17393042 |
| Molecular Formula | C14H12Cl2N6 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | CN(C)c1nc(N)nc(/C(C#N)=C/c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H12Cl2N6/c1-22(2)14-20-12(19-13(18)21-14)9(7-17)5-8-3-4-10(15)6-11(8)16/h3-6H,1-2H3,(H2,18,19,20,21)/b9-5+ |
| InChIKey | SWKVKKUAQUOWCL-WEVVVXLNSA-N |
| XLogP | 2.89 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|