C14H13ClN6 — CID 47016489
(Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)prop-2-enenitrile (PubChem CID 47016489) has the molecular formula C14H13ClN6 and a molecular weight of 300.75 g/mol. Its IUPAC name is (Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 47016489 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (Z)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(4-chlorophenyl)prop-2-enenitrile |
| SMILES | CN(C)c1nc(N)nc(/C(C#N)=C\c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H13ClN6/c1-21(2)14-19-12(18-13(17)20-14)10(8-16)7-9-3-5-11(15)6-4-9/h3-7H,1-2H3,(H2,17,18,19,20)/b10-7- |
| InChIKey | NZPLIXXYARBUQC-YFHOEESVSA-N |
| XLogP | 2.24 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|