C24H24N6O5 — CID 24582928
[4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate (PubChem CID 24582928) has the molecular formula C24H24N6O5 and a molecular weight of 476.49 g/mol. Its IUPAC name is [4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 24582928 |
| Molecular Formula | C24H24N6O5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C(\C#N)c3nc(N)nc(N(C)C)n3)cc2OC)cc1OC |
| InChI | InChI=1S/C24H24N6O5/c1-30(2)24-28-21(27-23(26)29-24)16(13-25)10-14-6-8-18(19(11-14)33-4)35-22(31)15-7-9-17(32-3)20(12-15)34-5/h6-12H,1-5H3,(H2,26,27,28,29)/b16-10+ |
| InChIKey | SWGCKRSXZNTXDU-MHWRWJLKSA-N |
| XLogP | 2.83 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|