C24H25N7O3 — CID 24583104
2-[4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 24583104) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 24583104 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[4-[(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-cyanoethenyl]-2-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(/C=C(\C#N)c2nc(N)nc(N(C)C)n2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H25N7O3/c1-4-33-20-13-16(12-17(14-25)22-28-23(26)30-24(29-22)31(2)3)10-11-19(20)34-15-21(32)27-18-8-6-5-7-9-18/h5-13H,4,15H2,1-3H3,(H,27,32)(H2,26,28,29,30)/b17-12+ |
| InChIKey | KMLWSJXCAGGHAM-SFQUDFHCSA-N |
| XLogP | 3.00 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|