C20H21N3O3 — CID 7946812
2-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide (PubChem CID 7946812) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 7946812 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[4-[(Z)-2-cyano-2-pyridin-2-ylethenyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide |
| SMILES | CCOc1cc(/C=C(\C#N)c2ccccn2)ccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C20H21N3O3/c1-4-25-19-12-15(8-9-18(19)26-14-20(24)23(2)3)11-16(13-21)17-7-5-6-10-22-17/h5-12H,4,14H2,1-3H3/b16-11+ |
| InChIKey | XQOXXSQCLLJSJE-LFIBNONCSA-N |
| XLogP | 3.01 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|