C28H24N4O5 — CID 135526039
2-[4-[2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(4-ethoxyphenyl)acetamide (PubChem CID 135526039) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-[4-[2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[4-[2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135526039 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-[4-[2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(C=C(C#N)c3nc4ccccc4c(=O)[nH]3)cc2OC)cc1 |
| InChI | InChI=1S/C28H24N4O5/c1-3-36-21-11-9-20(10-12-21)30-26(33)17-37-24-13-8-18(15-25(24)35-2)14-19(16-29)27-31-23-7-5-4-6-22(23)28(34)32-27/h4-15H,3,17H2,1-2H3,(H,30,33)(H,31,32,34) |
| InChIKey | NRWRGMGCGZDCFS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|