C27H22N4O4 — CID 135602708
2-[4-[(E)-2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 135602708) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 135602708 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[4-[(E)-2-cyano-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]-2-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C(\C#N)c2nc3ccccc3c(=O)[nH]2)ccc1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C27H22N4O4/c1-17-6-5-7-20(12-17)29-25(32)16-35-23-11-10-18(14-24(23)34-2)13-19(15-28)26-30-22-9-4-3-8-21(22)27(33)31-26/h3-14H,16H2,1-2H3,(H,29,32)(H,30,31,33)/b19-13+ |
| InChIKey | CWJDPWXSUDEOFP-CPNJWEJPSA-N |
| XLogP | 4.32 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|