C25H19N5O5 — CID 6237634
2-[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]-N-(4-nitrophenyl)acetamide (PubChem CID 6237634) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 6237634 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=C(\C#N)c2nc3ccccc3[nH]2)ccc1OCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H19N5O5/c1-34-23-13-16(12-17(14-26)25-28-20-4-2-3-5-21(20)29-25)6-11-22(23)35-15-24(31)27-18-7-9-19(10-8-18)30(32)33/h2-13H,15H2,1H3,(H,27,31)(H,28,29)/b17-12+ |
| InChIKey | VKQUKVLXPRCYFG-SFQUDFHCSA-N |
| XLogP | 4.56 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|