C28H25N3O3 — CID 136781560
(Z)-3-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 136781560) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is (Z)-3-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 136781560 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (Z)-3-[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc3ccccc3c(=O)[nH]2)ccc1OCc1cc(C)ccc1C |
| InChI | InChI=1S/C28H25N3O3/c1-4-33-26-15-20(11-12-25(26)34-17-22-13-18(2)9-10-19(22)3)14-21(16-29)27-30-24-8-6-5-7-23(24)28(32)31-27/h5-15H,4,17H2,1-3H3,(H,30,31,32)/b21-14- |
| InChIKey | MLEYFIUMTLGEKO-STZFKDTASA-N |
| XLogP | 5.58 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|