C29H23N3O2 — CID 126379337
(E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 126379337) has the molecular formula C29H23N3O2 and a molecular weight of 445.52 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126379337 |
| Molecular Formula | C29H23N3O2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)c2nc3ccccc3[nH]2)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H23N3O2/c1-2-33-28-17-20(16-23(18-30)29-31-25-12-5-6-13-26(25)32-29)14-15-27(28)34-19-22-10-7-9-21-8-3-4-11-24(21)22/h3-17H,2,19H2,1H3,(H,31,32)/b23-16+ |
| InChIKey | YFMHHQLZJNATKY-XQNSMLJCSA-N |
| XLogP | 6.76 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|