C22H18BrN3O5 — CID 135413367
ethyl 2-[4-[2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]acetate (PubChem CID 135413367) has the molecular formula C22H18BrN3O5 and a molecular weight of 484.31 g/mol. Its IUPAC name is ethyl 2-[4-[2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 135413367 |
| Molecular Formula | C22H18BrN3O5 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | ethyl 2-[4-[2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=C(C#N)c2nc3ccc(Br)cc3c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C22H18BrN3O5/c1-3-30-20(27)12-31-18-7-4-13(9-19(18)29-2)8-14(11-24)21-25-17-6-5-15(23)10-16(17)22(28)26-21/h4-10H,3,12H2,1-2H3,(H,25,26,28) |
| InChIKey | CPXDREKHKHKYMM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|