C16H9BrN4O — CID 135782649
(E)-2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-pyridin-4-ylprop-2-enenitrile (PubChem CID 135782649) has the molecular formula C16H9BrN4O and a molecular weight of 353.18 g/mol. Its IUPAC name is (E)-2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-pyridin-4-ylprop-2-enenitrile.
| Compound Name | (E)-2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-pyridin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 135782649 |
| Molecular Formula | C16H9BrN4O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | (E)-2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-pyridin-4-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccncc1)c1nc2ccc(Br)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H9BrN4O/c17-12-1-2-14-13(8-12)16(22)21-15(20-14)11(9-18)7-10-3-5-19-6-4-10/h1-8H,(H,20,21,22)/b11-7+ |
| InChIKey | USUSWYVFVFZWLT-YRNVUSSQSA-N |
| XLogP | 3.14 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|