C21H12BrN3O2 — CID 135413282
2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile (PubChem CID 135413282) has the molecular formula C21H12BrN3O2 and a molecular weight of 418.25 g/mol. Its IUPAC name is 2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile.
| Compound Name | 2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135413282 |
| Molecular Formula | C21H12BrN3O2 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2-(6-bromo-4-oxo-3H-quinazolin-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccccc2)o1)c1nc2ccc(Br)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H12BrN3O2/c22-15-6-8-18-17(11-15)21(26)25-20(24-18)14(12-23)10-16-7-9-19(27-16)13-4-2-1-3-5-13/h1-11H,(H,24,25,26) |
| InChIKey | RLJPRGMHYMEETN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|