C28H15N3O3 — CID 6045594
(E)-2-(1H-benzimidazol-2-yl)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]prop-2-enenitrile (PubChem CID 6045594) has the molecular formula C28H15N3O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6045594 |
| Molecular Formula | C28H15N3O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc3c(c2)C(=O)c2ccccc2C3=O)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H15N3O3/c29-15-17(28-30-23-7-3-4-8-24(23)31-28)13-18-10-12-25(34-18)16-9-11-21-22(14-16)27(33)20-6-2-1-5-19(20)26(21)32/h1-14H,(H,30,31)/b17-13+ |
| InChIKey | KXLJYBBNEXEKQV-GHRIWEEISA-N |
| XLogP | 5.66 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|