C22H12N4O3 — CID 2869837
2-(1H-benzimidazol-2-yl)-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enenitrile (PubChem CID 2869837) has the molecular formula C22H12N4O3 and a molecular weight of 380.36 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2869837 |
| Molecular Formula | C22H12N4O3 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H12N4O3/c23-11-13(20-24-17-3-1-2-4-18(17)25-20)9-14-6-8-19(29-14)12-5-7-15-16(10-12)22(28)26-21(15)27/h1-10H,(H,24,25)(H,26,27,28) |
| InChIKey | GWDOABDLMFJYER-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|