C20H12Cl3N3O — CID 90484481
(E)-2-(1H-benzimidazol-2-yl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride (PubChem CID 90484481) has the molecular formula C20H12Cl3N3O and a molecular weight of 416.70 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 90484481 |
| Molecular Formula | C20H12Cl3N3O |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile;hydrochloride |
| SMILES | Cl.N#C/C(=C\c1ccc(-c2ccc(Cl)cc2Cl)o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H11Cl2N3O.ClH/c21-13-5-7-15(16(22)10-13)19-8-6-14(26-19)9-12(11-23)20-24-17-3-1-2-4-18(17)25-20;/h1-10H,(H,24,25);1H/b12-9+; |
| InChIKey | YHBGJZFTBMJVTR-NBYYMMLRSA-N |
| XLogP | 6.62 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|