C20H11N4O4- — CID 7367543
2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-nitrophenolate (PubChem CID 7367543) has the molecular formula C20H11N4O4- and a molecular weight of 371.33 g/mol. Its IUPAC name is 2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-nitrophenolate.
| Compound Name | 2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7367543 |
| Molecular Formula | C20H11N4O4- |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-[5-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]furan-2-yl]-4-nitrophenolate |
| SMILES | N#C/C(=C\c1ccc(-c2cc([N+](=O)[O-])ccc2[O-])o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H12N4O4/c21-11-12(20-22-16-3-1-2-4-17(16)23-20)9-14-6-8-19(28-14)15-10-13(24(26)27)5-7-18(15)25/h1-10,25H,(H,22,23)/p-1/b12-9+ |
| InChIKey | UHEUOACZTPQECK-FMIVXFBMSA-M |
| XLogP | 3.87 |
| TPSA | 131.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|