C16H9FN4O2 — CID 2861401
2-(1H-benzimidazol-2-yl)-3-(2-fluoro-5-nitrophenyl)prop-2-enenitrile (PubChem CID 2861401) has the molecular formula C16H9FN4O2 and a molecular weight of 308.27 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(2-fluoro-5-nitrophenyl)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(2-fluoro-5-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2861401 |
| Molecular Formula | C16H9FN4O2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(2-fluoro-5-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc([N+](=O)[O-])ccc1F)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H9FN4O2/c17-13-6-5-12(21(22)23)8-10(13)7-11(9-18)16-19-14-3-1-2-4-15(14)20-16/h1-8H,(H,19,20) |
| InChIKey | ARXFSECDKMXHTC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|