C17H8Cl2N4O3 — CID 135492020
3-(2-chloro-5-nitrophenyl)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135492020) has the molecular formula C17H8Cl2N4O3 and a molecular weight of 387.18 g/mol. Its IUPAC name is 3-(2-chloro-5-nitrophenyl)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2-chloro-5-nitrophenyl)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135492020 |
| Molecular Formula | C17H8Cl2N4O3 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 3-(2-chloro-5-nitrophenyl)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc([N+](=O)[O-])ccc1Cl)c1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H8Cl2N4O3/c18-11-1-3-13-15(7-11)21-16(22-17(13)24)10(8-20)5-9-6-12(23(25)26)2-4-14(9)19/h1-7H,(H,21,22,24) |
| InChIKey | VAZUZFDJZHMFPD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|