C25H16ClN5O5 — CID 135413357
2-[2-[2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide (PubChem CID 135413357) has the molecular formula C25H16ClN5O5 and a molecular weight of 501.89 g/mol. Its IUPAC name is 2-[2-[2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 135413357 |
| Molecular Formula | C25H16ClN5O5 |
| Molecular Weight | 501.89 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 2-[2-[2-(6-chloro-4-oxo-3H-quinazolin-2-yl)-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide |
| SMILES | N#CC(=Cc1cc([N+](=O)[O-])ccc1OCC(=O)Nc1ccccc1)c1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H16ClN5O5/c26-17-6-8-21-20(12-17)25(33)30-24(29-21)16(13-27)10-15-11-19(31(34)35)7-9-22(15)36-14-23(32)28-18-4-2-1-3-5-18/h1-12H,14H2,(H,28,32)(H,29,30,33) |
| InChIKey | REXVAVBTARUQQK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 151.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|