C29H17BrN4O6S — CID 6197203
2-[2-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide (PubChem CID 6197203) has the molecular formula C29H17BrN4O6S and a molecular weight of 629.45 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 6197203 |
| Molecular Formula | C29H17BrN4O6S |
| Molecular Weight | 629.45 g/mol |
| Exact Mass | 628.01 |
| IUPAC Name | 2-[2-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-4-nitrophenoxy]-N-phenylacetamide |
| SMILES | N#C/C(=C\c1cc([N+](=O)[O-])ccc1OCC(=O)Nc1ccccc1)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C29H17BrN4O6S/c30-20-6-8-26-18(11-20)13-23(29(36)40-26)24-16-41-28(33-24)19(14-31)10-17-12-22(34(37)38)7-9-25(17)39-15-27(35)32-21-4-2-1-3-5-21/h1-13,16H,15H2,(H,32,35)/b19-10+ |
| InChIKey | HKZYUGXJFMHJRE-VXLYETTFSA-N |
| XLogP | 6.67 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.45 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|