C23H16N4O4S — CID 3653645
3-(3,5-dimethylanilino)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3653645) has the molecular formula C23H16N4O4S and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-(3,5-dimethylanilino)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(3,5-dimethylanilino)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3653645 |
| Molecular Formula | C23H16N4O4S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 3-(3,5-dimethylanilino)-2-[4-(6-nitro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C)cc(NC=C(C#N)c2nc(-c3cc4cc([N+](=O)[O-])ccc4oc3=O)cs2)c1 |
| InChI | InChI=1S/C23H16N4O4S/c1-13-5-14(2)7-17(6-13)25-11-16(10-24)22-26-20(12-32-22)19-9-15-8-18(27(29)30)3-4-21(15)31-23(19)28/h3-9,11-12,25H,1-2H3 |
| InChIKey | YMHAKZHISOCJCJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|