C12H7N3O4S — CID 3123886
3-(2-amino-1,3-thiazol-4-yl)-6-nitrochromen-2-one (PubChem CID 3123886) has the molecular formula C12H7N3O4S and a molecular weight of 289.27 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)-6-nitrochromen-2-one.
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)-6-nitrochromen-2-one |
|---|---|
| PubChem CID | 3123886 |
| Molecular Formula | C12H7N3O4S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)-6-nitrochromen-2-one |
| SMILES | Nc1nc(-c2cc3cc([N+](=O)[O-])ccc3oc2=O)cs1 |
| InChI | InChI=1S/C12H7N3O4S/c13-12-14-9(5-20-12)8-4-6-3-7(15(17)18)1-2-10(6)19-11(8)16/h1-5H,(H2,13,14) |
| InChIKey | PZEBBRJQMCRUQV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|