C17H12N2O8 — CID 2253092
3-(4,5-dimethoxy-2-nitrophenyl)-6-nitrochromen-2-one (PubChem CID 2253092) has the molecular formula C17H12N2O8 and a molecular weight of 372.29 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-nitrophenyl)-6-nitrochromen-2-one.
| Compound Name | 3-(4,5-dimethoxy-2-nitrophenyl)-6-nitrochromen-2-one |
|---|---|
| PubChem CID | 2253092 |
| Molecular Formula | C17H12N2O8 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-(4,5-dimethoxy-2-nitrophenyl)-6-nitrochromen-2-one |
| SMILES | COc1cc(-c2cc3cc([N+](=O)[O-])ccc3oc2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H12N2O8/c1-25-15-7-11(13(19(23)24)8-16(15)26-2)12-6-9-5-10(18(21)22)3-4-14(9)27-17(12)20/h3-8H,1-2H3 |
| InChIKey | SIDOWLWZPZFKJI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 134.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|