6-nitro-2-oxochromene-3-carbonyl chloride

C10H4ClNO5 — CID 12764546

IUPAC6-nitro-2-oxochromene-3-carbonyl chloride
SMILESO=C(Cl)c1cc2cc([N+](=O)[O-])ccc2oc1=O
InChIInChI=1S/C10H4ClNO5/c11-9(13)7-4-5-3-6(12(15)16)1-2-8(5)17-10(7)14/h1-4H
InChIKeySIGABXYVMQXSCM-UHFFFAOYSA-N
MW253.60 g/mol
LogP2.08
Rot. Bonds2

About 6-nitro-2-oxochromene-3-carbonyl chloride

6-nitro-2-oxochromene-3-carbonyl chloride (PubChem CID 12764546) has the molecular formula C10H4ClNO5 and a molecular weight of 253.60 g/mol. Its IUPAC name is 6-nitro-2-oxochromene-3-carbonyl chloride.

Molecular Properties

Compound Name6-nitro-2-oxochromene-3-carbonyl chloride
PubChem CID12764546
Molecular FormulaC10H4ClNO5
Molecular Weight253.60 g/mol
Exact Mass252.98
IUPAC Name6-nitro-2-oxochromene-3-carbonyl chloride
SMILESO=C(Cl)c1cc2cc([N+](=O)[O-])ccc2oc1=O
InChIInChI=1S/C10H4ClNO5/c11-9(13)7-4-5-3-6(12(15)16)1-2-8(5)17-10(7)14/h1-4H
InChIKeySIGABXYVMQXSCM-UHFFFAOYSA-N
XLogP2.08
TPSA90.42 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.60
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-nitro-2-oxochromene-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-nitro-2-oxochromene-3-carbonyl chloride?
The IUPAC name of 6-nitro-2-oxochromene-3-carbonyl chloride (CID 12764546) is 6-nitro-2-oxochromene-3-carbonyl chloride.
What is the SMILES notation for 6-nitro-2-oxochromene-3-carbonyl chloride?
The canonical SMILES for 6-nitro-2-oxochromene-3-carbonyl chloride is O=C(Cl)c1cc2cc([N+](=O)[O-])ccc2oc1=O.
What is the InChIKey of 6-nitro-2-oxochromene-3-carbonyl chloride?
The InChIKey is SIGABXYVMQXSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4ClNO5/c11-9(13)7-4-5-3-6(12(15)16)1-2-8(5)17-10(7)14/h1-4H.
What are the key properties of 6-nitro-2-oxochromene-3-carbonyl chloride?
6-nitro-2-oxochromene-3-carbonyl chloride has a molecular weight of 253.60 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-2-oxochromene-3-carbonyl chloride is sourced from PubChem (CID 12764546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).