C16H8Cl2N2O5 — CID 1111848
N-(3,4-dichlorophenyl)-6-nitro-2-oxochromene-3-carboxamide (PubChem CID 1111848) has the molecular formula C16H8Cl2N2O5 and a molecular weight of 379.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-nitro-2-oxochromene-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-nitro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1111848 |
| Molecular Formula | C16H8Cl2N2O5 |
| Molecular Weight | 379.16 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-nitro-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc2cc([N+](=O)[O-])ccc2oc1=O |
| InChI | InChI=1S/C16H8Cl2N2O5/c17-12-3-1-9(7-13(12)18)19-15(21)11-6-8-5-10(20(23)24)2-4-14(8)25-16(11)22/h1-7H,(H,19,21) |
| InChIKey | IMCCWVQUNZUTPB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.16 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|