C16H8Cl3NO3 — CID 100795015
6-chloro-N-(3,4-dichlorophenyl)-2-oxochromene-3-carboxamide (PubChem CID 100795015) has the molecular formula C16H8Cl3NO3 and a molecular weight of 368.60 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dichlorophenyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-chloro-N-(3,4-dichlorophenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 100795015 |
| Molecular Formula | C16H8Cl3NO3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 6-chloro-N-(3,4-dichlorophenyl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C16H8Cl3NO3/c17-9-1-4-14-8(5-9)6-11(16(22)23-14)15(21)20-10-2-3-12(18)13(19)7-10/h1-7H,(H,20,21) |
| InChIKey | LDYKLVDZZWTCSV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|