C18H12ClNO5 — CID 100795033
6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxochromene-3-carboxamide (PubChem CID 100795033) has the molecular formula C18H12ClNO5 and a molecular weight of 357.75 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 100795033 |
| Molecular Formula | C18H12ClNO5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1cc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C18H12ClNO5/c19-11-1-3-14-10(7-11)8-13(18(22)25-14)17(21)20-12-2-4-15-16(9-12)24-6-5-23-15/h1-4,7-9H,5-6H2,(H,20,21) |
| InChIKey | ZYNDWDSBAMCVQA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|