C18H13NO6 — CID 19207094
N-(1,3-benzodioxol-5-yl)-6-methoxy-2-oxochromene-3-carboxamide (PubChem CID 19207094) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 19207094 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc2oc(=O)c(C(=O)Nc3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C18H13NO6/c1-22-12-3-5-14-10(6-12)7-13(18(21)25-14)17(20)19-11-2-4-15-16(8-11)24-9-23-15/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | SNBYCBWNRSTIDN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|