C14H11N3O4S — CID 19207124
6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 19207124) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 19207124 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 6-methoxy-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc2oc(=O)c(C(=O)Nc3nnc(C)s3)cc2c1 |
| InChI | InChI=1S/C14H11N3O4S/c1-7-16-17-14(22-7)15-12(18)10-6-8-5-9(20-2)3-4-11(8)21-13(10)19/h3-6H,1-2H3,(H,15,17,18) |
| InChIKey | WTTXBVQOZAHGNK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|