C15H12N2O4S — CID 4913043
6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 4913043) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4913043 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc2oc(=O)c(C(=O)Nc3nc(C)cs3)cc2c1 |
| InChI | InChI=1S/C15H12N2O4S/c1-8-7-22-15(16-8)17-13(18)11-6-9-5-10(20-2)3-4-12(9)21-14(11)19/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | HFOMGRJNIANLBN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|