C14H11NO3S — CID 657928
6-methoxy-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one (PubChem CID 657928) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 6-methoxy-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one.
| Compound Name | 6-methoxy-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 657928 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 6-methoxy-3-(4-methyl-1,3-thiazol-2-yl)chromen-2-one |
| SMILES | COc1ccc2oc(=O)c(-c3nc(C)cs3)cc2c1 |
| InChI | InChI=1S/C14H11NO3S/c1-8-7-19-13(15-8)11-6-9-5-10(17-2)3-4-12(9)18-14(11)16/h3-7H,1-2H3 |
| InChIKey | JRPVSVZSUPSYOM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|