C19H14ClN3O4S — CID 3304590
3-[5-(5-chloro-2-methoxyanilino)-1,3,4-thiadiazol-2-yl]-6-methoxychromen-2-one (PubChem CID 3304590) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is 3-[5-(5-chloro-2-methoxyanilino)-1,3,4-thiadiazol-2-yl]-6-methoxychromen-2-one.
| Compound Name | 3-[5-(5-chloro-2-methoxyanilino)-1,3,4-thiadiazol-2-yl]-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 3304590 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-[5-(5-chloro-2-methoxyanilino)-1,3,4-thiadiazol-2-yl]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)c(-c3nnc(Nc4cc(Cl)ccc4OC)s3)cc2c1 |
| InChI | InChI=1S/C19H14ClN3O4S/c1-25-12-4-6-15-10(7-12)8-13(18(24)27-15)17-22-23-19(28-17)21-14-9-11(20)3-5-16(14)26-2/h3-9H,1-2H3,(H,21,23) |
| InChIKey | WKQSIUPORPMNFU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|