C20H13FN2O4S — CID 19207167
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-6-methoxy-2-oxochromene-3-carboxamide (PubChem CID 19207167) has the molecular formula C20H13FN2O4S and a molecular weight of 396.40 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-6-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-6-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 19207167 |
| Molecular Formula | C20H13FN2O4S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-6-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc2oc(=O)c(C(=O)Nc3nc(-c4ccc(F)cc4)cs3)cc2c1 |
| InChI | InChI=1S/C20H13FN2O4S/c1-26-14-6-7-17-12(8-14)9-15(19(25)27-17)18(24)23-20-22-16(10-28-20)11-2-4-13(21)5-3-11/h2-10H,1H3,(H,22,23,24) |
| InChIKey | YYWAKYSOQQIQBZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|