C21H13N3O8S — CID 21205537
2-[[4-(6-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]carbamoyl]-4-nitrobenzoic acid (PubChem CID 21205537) has the molecular formula C21H13N3O8S and a molecular weight of 467.42 g/mol. Its IUPAC name is 2-[[4-(6-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]carbamoyl]-4-nitrobenzoic acid.
| Compound Name | 2-[[4-(6-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]carbamoyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 21205537 |
| Molecular Formula | C21H13N3O8S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 2-[[4-(6-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]carbamoyl]-4-nitrobenzoic acid |
| SMILES | COc1ccc2oc(=O)c(-c3csc(NC(=O)c4cc([N+](=O)[O-])ccc4C(=O)O)n3)cc2c1 |
| InChI | InChI=1S/C21H13N3O8S/c1-31-12-3-5-17-10(6-12)7-15(20(28)32-17)16-9-33-21(22-16)23-18(25)14-8-11(24(29)30)2-4-13(14)19(26)27/h2-9H,1H3,(H,26,27)(H,22,23,25) |
| InChIKey | ZZQFGNRUYXLREY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 161.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|