C17H11N3O8 — CID 21205557
N-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carboxamide (PubChem CID 21205557) has the molecular formula C17H11N3O8 and a molecular weight of 385.29 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 21205557 |
| Molecular Formula | C17H11N3O8 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc2oc(=O)c(C(=O)Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2c1 |
| InChI | InChI=1S/C17H11N3O8/c1-27-11-3-5-15-9(6-11)7-12(17(22)28-15)16(21)18-13-4-2-10(19(23)24)8-14(13)20(25)26/h2-8H,1H3,(H,18,21) |
| InChIKey | AHTFBFAKJWGPAE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 154.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|