C17H12N4O8 — CID 3131118
N'-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carbohydrazide (PubChem CID 3131118) has the molecular formula C17H12N4O8 and a molecular weight of 400.30 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carbohydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 3131118 |
| Molecular Formula | C17H12N4O8 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-6-methoxy-2-oxochromene-3-carbohydrazide |
| SMILES | COc1ccc2oc(=O)c(C(=O)NNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2c1 |
| InChI | InChI=1S/C17H12N4O8/c1-28-11-3-5-15-9(6-11)7-12(17(23)29-15)16(22)19-18-13-4-2-10(20(24)25)8-14(13)21(26)27/h2-8,18H,1H3,(H,19,22) |
| InChIKey | FHUBHHULWRTZMF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|