C18H13NO5 — CID 100794451
N-(1,3-benzodioxol-5-yl)-6-methyl-2-oxochromene-3-carboxamide (PubChem CID 100794451) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-methyl-2-oxochromene-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 100794451 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-methyl-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc2oc(=O)c(C(=O)Nc3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C18H13NO5/c1-10-2-4-14-11(6-10)7-13(18(21)24-14)17(20)19-12-3-5-15-16(8-12)23-9-22-15/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | KVDSSPZWJVPKAJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|