C17H10ClNO5 — CID 100794837
N-(1,3-benzodioxol-5-yl)-8-chloro-2-oxochromene-3-carboxamide (PubChem CID 100794837) has the molecular formula C17H10ClNO5 and a molecular weight of 343.72 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-8-chloro-2-oxochromene-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-8-chloro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 100794837 |
| Molecular Formula | C17H10ClNO5 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-8-chloro-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc2cccc(Cl)c2oc1=O |
| InChI | InChI=1S/C17H10ClNO5/c18-12-3-1-2-9-6-11(17(21)24-15(9)12)16(20)19-10-4-5-13-14(7-10)23-8-22-13/h1-7H,8H2,(H,19,20) |
| InChIKey | VOZXHHISDUHPFW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|