C19H16ClNO3 — CID 100794927
8-chloro-2-oxo-N-(2,4,6-trimethylphenyl)chromene-3-carboxamide (PubChem CID 100794927) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 8-chloro-2-oxo-N-(2,4,6-trimethylphenyl)chromene-3-carboxamide.
| Compound Name | 8-chloro-2-oxo-N-(2,4,6-trimethylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 100794927 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 8-chloro-2-oxo-N-(2,4,6-trimethylphenyl)chromene-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cc3cccc(Cl)c3oc2=O)c(C)c1 |
| InChI | InChI=1S/C19H16ClNO3/c1-10-7-11(2)16(12(3)8-10)21-18(22)14-9-13-5-4-6-15(20)17(13)24-19(14)23/h4-9H,1-3H3,(H,21,22) |
| InChIKey | MTJOOFKYGFZILE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|